C28H24F3N3O5S2 — CID 142263832
butyl N-[2-[[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]amino]phenyl]sulfonylcarbamate (PubChem CID 142263832) has the molecular formula C28H24F3N3O5S2 and a molecular weight of 603.64 g/mol. Its IUPAC name is butyl N-[2-[[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]amino]phenyl]sulfonylcarbamate.
| Compound Name | butyl N-[2-[[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]amino]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 142263832 |
| Molecular Formula | C28H24F3N3O5S2 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | butyl N-[2-[[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]amino]phenyl]sulfonylcarbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)cs2)cc1 |
| InChI | InChI=1S/C28H24F3N3O5S2/c1-2-3-16-39-27(36)34-41(37,38)24-7-5-4-6-22(24)32-25(35)19-8-10-20(11-9-19)26-33-23(17-40-26)18-12-14-21(15-13-18)28(29,30)31/h4-15,17H,2-3,16H2,1H3,(H,32,35)(H,34,36) |
| InChIKey | DGLYJDDMEYISIQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|