C17H14N2OS — CID 1483692
N-methyl-4-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 1483692) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is N-methyl-4-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-methyl-4-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 1483692 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-methyl-4-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CNC(=O)c1ccc(-c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H14N2OS/c1-18-16(20)13-7-9-14(10-8-13)17-19-15(11-21-17)12-5-3-2-4-6-12/h2-11H,1H3,(H,18,20) |
| InChIKey | UKYQDZNWUGZHPW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |