C26H21F7N4O6S — CID 58874634
N-[2-(hexanoylsulfamoyl)phenyl]-3-nitro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]benzamide (PubChem CID 58874634) has the molecular formula C26H21F7N4O6S and a molecular weight of 650.53 g/mol. Its IUPAC name is N-[2-(hexanoylsulfamoyl)phenyl]-3-nitro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]benzamide.
| Compound Name | N-[2-(hexanoylsulfamoyl)phenyl]-3-nitro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 58874634 |
| Molecular Formula | C26H21F7N4O6S |
| Molecular Weight | 650.53 g/mol |
| Exact Mass | 650.11 |
| IUPAC Name | N-[2-(hexanoylsulfamoyl)phenyl]-3-nitro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]benzamide |
| SMILES | CCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21F7N4O6S/c1-2-3-4-9-18(38)36-44(42,43)17-8-6-5-7-15(17)35-25(39)13-10-11-14(16(12-13)37(40)41)34-24-22(29)20(27)19(26(31,32)33)21(28)23(24)30/h5-8,10-12,34H,2-4,9H2,1H3,(H,35,39)(H,36,38) |
| InChIKey | GOVNZFIKINKINV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|