C27H36N2O4S — CID 18544135
N-[2-(hexanoylsulfamoyl)phenyl]-4-[(E)-oct-1-enyl]benzamide (PubChem CID 18544135) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is N-[2-(hexanoylsulfamoyl)phenyl]-4-[(E)-oct-1-enyl]benzamide.
| Compound Name | N-[2-(hexanoylsulfamoyl)phenyl]-4-[(E)-oct-1-enyl]benzamide |
|---|---|
| PubChem CID | 18544135 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[2-(hexanoylsulfamoyl)phenyl]-4-[(E)-oct-1-enyl]benzamide |
| SMILES | CCCCCC/C=C/c1ccc(C(=O)Nc2ccccc2S(=O)(=O)NC(=O)CCCCC)cc1 |
| InChI | InChI=1S/C27H36N2O4S/c1-3-5-7-8-9-11-14-22-18-20-23(21-19-22)27(31)28-24-15-12-13-16-25(24)34(32,33)29-26(30)17-10-6-4-2/h11-16,18-21H,3-10,17H2,1-2H3,(H,28,31)(H,29,30)/b14-11+ |
| InChIKey | JTTMIQAOILFLNP-SDNWHVSQSA-N |
| XLogP | 6.31 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|