C33H32N2O5S — CID 12041310
3-[(4-tert-butylphenyl)methoxy]-N-[2-[[(E)-3-phenylprop-2-enoyl]sulfamoyl]phenyl]benzamide (PubChem CID 12041310) has the molecular formula C33H32N2O5S and a molecular weight of 568.70 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methoxy]-N-[2-[[(E)-3-phenylprop-2-enoyl]sulfamoyl]phenyl]benzamide.
| Compound Name | 3-[(4-tert-butylphenyl)methoxy]-N-[2-[[(E)-3-phenylprop-2-enoyl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 12041310 |
| Molecular Formula | C33H32N2O5S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methoxy]-N-[2-[[(E)-3-phenylprop-2-enoyl]sulfamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(COc2cccc(C(=O)Nc3ccccc3S(=O)(=O)NC(=O)/C=C/c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H32N2O5S/c1-33(2,3)27-19-16-25(17-20-27)23-40-28-13-9-12-26(22-28)32(37)34-29-14-7-8-15-30(29)41(38,39)35-31(36)21-18-24-10-5-4-6-11-24/h4-22H,23H2,1-3H3,(H,34,37)(H,35,36)/b21-18+ |
| InChIKey | DOUCIGIQBWTIRX-DYTRJAOYSA-N |
| XLogP | 6.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|