C42H54N4O9S2 — CID 158620907
N-[2-(acetylsulfamoyl)phenyl]-3-heptoxybenzamide;N-(2-aminoperoxysulfanylphenyl)-3-heptoxybenzamide (PubChem CID 158620907) has the molecular formula C42H54N4O9S2 and a molecular weight of 823.05 g/mol. Its IUPAC name is N-[2-(acetylsulfamoyl)phenyl]-3-heptoxybenzamide;N-(2-aminoperoxysulfanylphenyl)-3-heptoxybenzamide.
| Compound Name | N-[2-(acetylsulfamoyl)phenyl]-3-heptoxybenzamide;N-(2-aminoperoxysulfanylphenyl)-3-heptoxybenzamide |
|---|---|
| PubChem CID | 158620907 |
| Molecular Formula | C42H54N4O9S2 |
| Molecular Weight | 823.05 g/mol |
| Exact Mass | 822.33 |
| IUPAC Name | N-[2-(acetylsulfamoyl)phenyl]-3-heptoxybenzamide;N-(2-aminoperoxysulfanylphenyl)-3-heptoxybenzamide |
| SMILES | CCCCCCCOc1cccc(C(=O)Nc2ccccc2S(=O)(=O)NC(C)=O)c1.CCCCCCCOc1cccc(C(=O)Nc2ccccc2SOON)c1 |
| InChI | InChI=1S/C22H28N2O5S.C20H26N2O4S/c1-3-4-5-6-9-15-29-19-12-10-11-18(16-19)22(26)23-20-13-7-8-14-21(20)30(27,28)24-17(2)25;1-2-3-4-5-8-14-24-17-11-9-10-16(15-17)20(23)22-18-12-6-7-13-19(18)27-26-25-21/h7-8,10-14,16H,3-6,9,15H2,1-2H3,(H,23,26)(H,24,25);6-7,9-13,15H,2-5,8,14,21H2,1H3,(H,22,23) |
| InChIKey | HXZAQPRMRZDWKB-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 184.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.05 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|