C10H10FN5O3S — CID 61130568
N-(5-fluoro-2-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 61130568) has the molecular formula C10H10FN5O3S and a molecular weight of 299.29 g/mol. Its IUPAC name is N-(5-fluoro-2-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(5-fluoro-2-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 61130568 |
| Molecular Formula | C10H10FN5O3S |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(5-fluoro-2-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(F)cc1NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C10H10FN5O3S/c11-7-1-2-9(20(12,18)19)8(3-7)15-10(17)4-16-6-13-5-14-16/h1-3,5-6H,4H2,(H,15,17)(H2,12,18,19) |
| InChIKey | HYUMLSBFQBHKBO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |