C12H9F3N4O — CID 62237786
6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 62237786) has the molecular formula C12H9F3N4O and a molecular weight of 282.23 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62237786 |
| Molecular Formula | C12H9F3N4O |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | NNc1cccc(C(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H9F3N4O/c13-6-4-5-7(11(15)10(6)14)18-12(20)8-2-1-3-9(17-8)19-16/h1-5H,16H2,(H,17,19)(H,18,20) |
| InChIKey | WYBDYNGSSDTGBF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|