C16H14F3N3O — CID 84573602
6-pyrrolidin-1-yl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 84573602) has the molecular formula C16H14F3N3O and a molecular weight of 321.30 g/mol. Its IUPAC name is 6-pyrrolidin-1-yl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 6-pyrrolidin-1-yl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 84573602 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 6-pyrrolidin-1-yl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cccc(N2CCCC2)n1 |
| InChI | InChI=1S/C16H14F3N3O/c17-10-6-7-11(15(19)14(10)18)21-16(23)12-4-3-5-13(20-12)22-8-1-2-9-22/h3-7H,1-2,8-9H2,(H,21,23) |
| InChIKey | UUGQUSXJMXQRQL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|