C12H10F2N4O — CID 55050646
N-(2,6-difluorophenyl)-6-hydrazinylpyridine-2-carboxamide (PubChem CID 55050646) has the molecular formula C12H10F2N4O and a molecular weight of 264.24 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-6-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-6-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 55050646 |
| Molecular Formula | C12H10F2N4O |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-(2,6-difluorophenyl)-6-hydrazinylpyridine-2-carboxamide |
| SMILES | NNc1cccc(C(=O)Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C12H10F2N4O/c13-7-3-1-4-8(14)11(7)17-12(19)9-5-2-6-10(16-9)18-15/h1-6H,15H2,(H,16,18)(H,17,19) |
| InChIKey | BSIAQLFRFHZVSI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|