C12H12BrN5O2 — CID 60982809
4-bromo-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]benzamide (PubChem CID 60982809) has the molecular formula C12H12BrN5O2 and a molecular weight of 338.17 g/mol. Its IUPAC name is 4-bromo-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 60982809 |
| Molecular Formula | C12H12BrN5O2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4-bromo-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)NCc1ncn[nH]1 |
| InChI | InChI=1S/C12H12BrN5O2/c13-9-3-1-8(2-4-9)12(20)15-6-11(19)14-5-10-16-7-17-18-10/h1-4,7H,5-6H2,(H,14,19)(H,15,20)(H,16,17,18) |
| InChIKey | BVWQXIBRRVUDMG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |