C8H13N5O — CID 116656324
1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea (PubChem CID 116656324) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea.
| Compound Name | 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 116656324 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ncn[nH]1)NC1CCC1 |
| InChI | InChI=1S/C8H13N5O/c14-8(12-6-2-1-3-6)9-4-7-10-5-11-13-7/h5-6H,1-4H2,(H2,9,12,14)(H,10,11,13) |
| InChIKey | YFIZUKHXGZIZSH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |