About 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea
1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea (PubChem CID 116656324) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
| PubChem CID | 116656324 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ncn[nH]1)NC1CCC1 |
| InChI | InChI=1S/C8H13N5O/c14-8(12-6-2-1-3-6)9-4-7-10-5-11-13-7/h5-6H,1-4H2,(H2,9,12,14)(H,10,11,13) |
| InChIKey | YFIZUKHXGZIZSH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea?
The IUPAC name of 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea (CID 116656324) is 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea.
What is the SMILES notation for 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea?
The canonical SMILES for 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea is O=C(NCc1ncn[nH]1)NC1CCC1.
What is the InChIKey of 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea?
The InChIKey is YFIZUKHXGZIZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c14-8(12-6-2-1-3-6)9-4-7-10-5-11-13-7/h5-6H,1-4H2,(H2,9,12,14)(H,10,11,13).
What are the key properties of 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea?
1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea has a molecular weight of 195.23 g/mol, XLogP of 0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-(1H-1,2,4-triazol-5-ylmethyl)urea is sourced from PubChem (CID 116656324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).