C12H19N5O3 — CID 106319787
cis-(1R,3S)-3-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]cyclopentane-1-carboxylic acid (PubChem CID 106319787) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is cis-(1R,3S)-3-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106319787 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | cis-(1R,3S)-3-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NCCCc1ncn[nH]1)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H19N5O3/c18-11(19)8-3-4-9(6-8)16-12(20)13-5-1-2-10-14-7-15-17-10/h7-9H,1-6H2,(H,18,19)(H2,13,16,20)(H,14,15,17)/t8-,9+/m1/s1 |
| InChIKey | LIJVYQIDNVLIFR-BDAKNGLRSA-N |
| XLogP | 0.29 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|