C13H21N5O3 — CID 64532182
2-[1-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]piperidin-2-yl]acetic acid (PubChem CID 64532182) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[1-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 64532182 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[1-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]piperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H21N5O3/c19-12(20)8-10-4-1-2-7-18(10)13(21)14-6-3-5-11-15-9-16-17-11/h9-10H,1-8H2,(H,14,21)(H,19,20)(H,15,16,17) |
| InChIKey | BTKMIVHGPANACZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|