C13H22N4O — CID 54884851
4-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide (PubChem CID 54884851) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide.
| Compound Name | 4-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 54884851 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-cyclohexyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
| SMILES | O=C(CCCC1CCCCC1)NCc1ncn[nH]1 |
| InChI | InChI=1S/C13H22N4O/c18-13(14-9-12-15-10-16-17-12)8-4-7-11-5-2-1-3-6-11/h10-11H,1-9H2,(H,14,18)(H,15,16,17) |
| InChIKey | HHQNGFUFMKDDQC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |