C20H17ClFN3O — CID 166721195
(E)-N-[2-[2-(4-chlorophenyl)-1H-imidazol-5-yl]ethyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 166721195) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is (E)-N-[2-[2-(4-chlorophenyl)-1H-imidazol-5-yl]ethyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[2-(4-chlorophenyl)-1H-imidazol-5-yl]ethyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 166721195 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (E)-N-[2-[2-(4-chlorophenyl)-1H-imidazol-5-yl]ethyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCc1cnc(-c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C20H17ClFN3O/c21-16-6-4-15(5-7-16)20-24-13-18(25-20)11-12-23-19(26)10-3-14-1-8-17(22)9-2-14/h1-10,13H,11-12H2,(H,23,26)(H,24,25)/b10-3+ |
| InChIKey | FKLNKRYWBXGRMN-XCVCLJGOSA-N |
| XLogP | 4.24 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|