C15H15FN4O — CID 94100089
(Z)-3-(4-fluorophenyl)-N-[2-(pyrazin-2-ylamino)ethyl]prop-2-enamide (PubChem CID 94100089) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is (Z)-3-(4-fluorophenyl)-N-[2-(pyrazin-2-ylamino)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(4-fluorophenyl)-N-[2-(pyrazin-2-ylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 94100089 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (Z)-3-(4-fluorophenyl)-N-[2-(pyrazin-2-ylamino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc(F)cc1)NCCNc1cnccn1 |
| InChI | InChI=1S/C15H15FN4O/c16-13-4-1-12(2-5-13)3-6-15(21)20-10-9-19-14-11-17-7-8-18-14/h1-8,11H,9-10H2,(H,18,19)(H,20,21)/b6-3- |
| InChIKey | UZWQTJHBKVJODZ-UTCJRWHESA-N |
| XLogP | 1.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|