C20H15F2N3O — CID 122262836
(E)-3-(4-fluorophenyl)-N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]prop-2-enamide (PubChem CID 122262836) has the molecular formula C20H15F2N3O and a molecular weight of 351.36 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122262836 |
| Molecular Formula | C20H15F2N3O |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCc1cc(-c2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C20H15F2N3O/c21-16-6-1-14(2-7-16)3-10-20(26)23-12-18-11-19(25-13-24-18)15-4-8-17(22)9-5-15/h1-11,13H,12H2,(H,23,26)/b10-3+ |
| InChIKey | LIURTQHSYLFMCJ-XCVCLJGOSA-N |
| XLogP | 3.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|