C11H10FN5O — CID 78977264
3-(4-fluorophenyl)-N-(2H-tetrazol-5-ylmethyl)prop-2-enamide (PubChem CID 78977264) has the molecular formula C11H10FN5O and a molecular weight of 247.23 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(2H-tetrazol-5-ylmethyl)prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-(2H-tetrazol-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78977264 |
| Molecular Formula | C11H10FN5O |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(2H-tetrazol-5-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NCc1nn[nH]n1 |
| InChI | InChI=1S/C11H10FN5O/c12-9-4-1-8(2-5-9)3-6-11(18)13-7-10-14-16-17-15-10/h1-6H,7H2,(H,13,18)(H,14,15,16,17) |
| InChIKey | OLUFGDDOFFUWEE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|