C20H14FN5O — CID 122263018
N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]quinoxaline-6-carboxamide (PubChem CID 122263018) has the molecular formula C20H14FN5O and a molecular weight of 359.36 g/mol. Its IUPAC name is N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]quinoxaline-6-carboxamide.
| Compound Name | N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 122263018 |
| Molecular Formula | C20H14FN5O |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[[6-(4-fluorophenyl)pyrimidin-4-yl]methyl]quinoxaline-6-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccc(F)cc2)ncn1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C20H14FN5O/c21-15-4-1-13(2-5-15)18-10-16(25-12-26-18)11-24-20(27)14-3-6-17-19(9-14)23-8-7-22-17/h1-10,12H,11H2,(H,24,27) |
| InChIKey | BXVNLTZILCPTFT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |