C18H16Cl2FN3OS — CID 9153751
1-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea (PubChem CID 9153751) has the molecular formula C18H16Cl2FN3OS and a molecular weight of 412.32 g/mol. Its IUPAC name is 1-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 9153751 |
| Molecular Formula | C18H16Cl2FN3OS |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 1-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-[2-(4-chlorophenyl)ethyl]thiourea |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)NNC(=S)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2FN3OS/c19-13-6-4-12(5-7-13)10-11-22-18(26)24-23-17(25)9-8-14-15(20)2-1-3-16(14)21/h1-9H,10-11H2,(H,23,25)(H2,22,24,26)/b9-8+ |
| InChIKey | NYVBNVKDOXQRGO-CMDGGOBGSA-N |
| XLogP | 3.88 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|