C11H12ClF3N2O3S — CID 65387463
2-chloro-N-ethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 65387463) has the molecular formula C11H12ClF3N2O3S and a molecular weight of 344.74 g/mol. Its IUPAC name is 2-chloro-N-ethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-N-ethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 65387463 |
| Molecular Formula | C11H12ClF3N2O3S |
| Molecular Weight | 344.74 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-chloro-N-ethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O3S/c1-2-17(6-11(13,14)15)10(18)8-5-7(21(16,19)20)3-4-9(8)12/h3-5H,2,6H2,1H3,(H2,16,19,20) |
| InChIKey | FIJADMCNGWYYDR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |