C12H15F3N2O3S — CID 62046315
N,2,4-trimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 62046315) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is N,2,4-trimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N,2,4-trimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 62046315 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N,2,4-trimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O3S/c1-7-4-8(2)10(21(16,19)20)5-9(7)11(18)17(3)6-12(13,14)15/h4-5H,6H2,1-3H3,(H2,16,19,20) |
| InChIKey | FVBLAFUJNMMXIC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |