C17H21ClN2O3S2 — CID 24655700
N-[(5-chlorothiophen-2-yl)methyl]-5-(dimethylsulfamoyl)-N-ethyl-2-methylbenzamide (PubChem CID 24655700) has the molecular formula C17H21ClN2O3S2 and a molecular weight of 400.95 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-5-(dimethylsulfamoyl)-N-ethyl-2-methylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-5-(dimethylsulfamoyl)-N-ethyl-2-methylbenzamide |
|---|---|
| PubChem CID | 24655700 |
| Molecular Formula | C17H21ClN2O3S2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-5-(dimethylsulfamoyl)-N-ethyl-2-methylbenzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C17H21ClN2O3S2/c1-5-20(11-13-7-9-16(18)24-13)17(21)15-10-14(8-6-12(15)2)25(22,23)19(3)4/h6-10H,5,11H2,1-4H3 |
| InChIKey | DOKXSRLSOVZHHW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |