C25H28N2O3S — CID 24676552
N-benzyl-5-(dimethylsulfamoyl)-2-methyl-N-(2-phenylethyl)benzamide (PubChem CID 24676552) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-benzyl-5-(dimethylsulfamoyl)-2-methyl-N-(2-phenylethyl)benzamide.
| Compound Name | N-benzyl-5-(dimethylsulfamoyl)-2-methyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 24676552 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-benzyl-5-(dimethylsulfamoyl)-2-methyl-N-(2-phenylethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-20-14-15-23(31(29,30)26(2)3)18-24(20)25(28)27(19-22-12-8-5-9-13-22)17-16-21-10-6-4-7-11-21/h4-15,18H,16-17,19H2,1-3H3 |
| InChIKey | XAZMFVNIFQYYCD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |