C22H21N3O — CID 123934707
N'-(1-ethyl-2-methylindol-3-yl)naphthalene-1-carbohydrazide (PubChem CID 123934707) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is N'-(1-ethyl-2-methylindol-3-yl)naphthalene-1-carbohydrazide.
| Compound Name | N'-(1-ethyl-2-methylindol-3-yl)naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 123934707 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N'-(1-ethyl-2-methylindol-3-yl)naphthalene-1-carbohydrazide |
| SMILES | CCn1c(C)c(NNC(=O)c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C22H21N3O/c1-3-25-15(2)21(19-12-6-7-14-20(19)25)23-24-22(26)18-13-8-10-16-9-4-5-11-17(16)18/h4-14,23H,3H2,1-2H3,(H,24,26) |
| InChIKey | NGHLVQPFSMWJSC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|