C38H40N2O3 — CID 19024827
4-[3-[3-[benzyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]benzoyl]indol-1-yl]butanoic acid (PubChem CID 19024827) has the molecular formula C38H40N2O3 and a molecular weight of 572.75 g/mol. Its IUPAC name is 4-[3-[3-[benzyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]benzoyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-[3-[benzyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]benzoyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 19024827 |
| Molecular Formula | C38H40N2O3 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 4-[3-[3-[benzyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]benzoyl]indol-1-yl]butanoic acid |
| SMILES | CC(C)Cc1ccc(C(C)N(Cc2ccccc2)c2cccc(C(=O)c3cn(CCCC(=O)O)c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C38H40N2O3/c1-27(2)23-29-18-20-31(21-19-29)28(3)40(25-30-11-5-4-6-12-30)33-14-9-13-32(24-33)38(43)35-26-39(22-10-17-37(41)42)36-16-8-7-15-34(35)36/h4-9,11-16,18-21,24,26-28H,10,17,22-23,25H2,1-3H3,(H,41,42) |
| InChIKey | DQASTISFUCFYFE-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |