C31H31N3O3 — CID 57040532
4-[3-[3-[[cyano-[4-(2-methylpropyl)phenyl]methyl]amino]benzoyl]indol-1-yl]butanoic acid (PubChem CID 57040532) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is 4-[3-[3-[[cyano-[4-(2-methylpropyl)phenyl]methyl]amino]benzoyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-[3-[[cyano-[4-(2-methylpropyl)phenyl]methyl]amino]benzoyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 57040532 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 4-[3-[3-[[cyano-[4-(2-methylpropyl)phenyl]methyl]amino]benzoyl]indol-1-yl]butanoic acid |
| SMILES | CC(C)Cc1ccc(C(C#N)Nc2cccc(C(=O)c3cn(CCCC(=O)O)c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C31H31N3O3/c1-21(2)17-22-12-14-23(15-13-22)28(19-32)33-25-8-5-7-24(18-25)31(37)27-20-34(16-6-11-30(35)36)29-10-4-3-9-26(27)29/h3-5,7-10,12-15,18,20-21,28,33H,6,11,16-17H2,1-2H3,(H,35,36) |
| InChIKey | KHKTUXOLBPZWJH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |