C30H46N2O3 — CID 139750145
ethyl 4-[5-ethyl-4-[3-(2-ethyloctylamino)benzoyl]-1-methylpyrrol-2-yl]butanoate (PubChem CID 139750145) has the molecular formula C30H46N2O3 and a molecular weight of 482.71 g/mol. Its IUPAC name is ethyl 4-[5-ethyl-4-[3-(2-ethyloctylamino)benzoyl]-1-methylpyrrol-2-yl]butanoate.
| Compound Name | ethyl 4-[5-ethyl-4-[3-(2-ethyloctylamino)benzoyl]-1-methylpyrrol-2-yl]butanoate |
|---|---|
| PubChem CID | 139750145 |
| Molecular Formula | C30H46N2O3 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | ethyl 4-[5-ethyl-4-[3-(2-ethyloctylamino)benzoyl]-1-methylpyrrol-2-yl]butanoate |
| SMILES | CCCCCCC(CC)CNc1cccc(C(=O)c2cc(CCCC(=O)OCC)n(C)c2CC)c1 |
| InChI | InChI=1S/C30H46N2O3/c1-6-10-11-12-15-23(7-2)22-31-25-17-13-16-24(20-25)30(34)27-21-26(32(5)28(27)8-3)18-14-19-29(33)35-9-4/h13,16-17,20-21,23,31H,6-12,14-15,18-19,22H2,1-5H3 |
| InChIKey | ZXNIPZLRVMFJJQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|