C26H38N2O3 — CID 139750199
4-[5-ethyl-1-methyl-4-[3-(6-methylheptylamino)benzoyl]pyrrol-2-yl]butanoic acid (PubChem CID 139750199) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is 4-[5-ethyl-1-methyl-4-[3-(6-methylheptylamino)benzoyl]pyrrol-2-yl]butanoic acid.
| Compound Name | 4-[5-ethyl-1-methyl-4-[3-(6-methylheptylamino)benzoyl]pyrrol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 139750199 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 4-[5-ethyl-1-methyl-4-[3-(6-methylheptylamino)benzoyl]pyrrol-2-yl]butanoic acid |
| SMILES | CCc1c(C(=O)c2cccc(NCCCCCC(C)C)c2)cc(CCCC(=O)O)n1C |
| InChI | InChI=1S/C26H38N2O3/c1-5-24-23(18-22(28(24)4)14-10-15-25(29)30)26(31)20-12-9-13-21(17-20)27-16-8-6-7-11-19(2)3/h9,12-13,17-19,27H,5-8,10-11,14-16H2,1-4H3,(H,29,30) |
| InChIKey | KNJGGOWRNLRQNZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|