C25H36N2O3 — CID 139750084
4-[3-ethyl-4-[3-(octylamino)benzoyl]pyrrol-1-yl]butanoic acid (PubChem CID 139750084) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 4-[3-ethyl-4-[3-(octylamino)benzoyl]pyrrol-1-yl]butanoic acid.
| Compound Name | 4-[3-ethyl-4-[3-(octylamino)benzoyl]pyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 139750084 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 4-[3-ethyl-4-[3-(octylamino)benzoyl]pyrrol-1-yl]butanoic acid |
| SMILES | CCCCCCCCNc1cccc(C(=O)c2cn(CCCC(=O)O)cc2CC)c1 |
| InChI | InChI=1S/C25H36N2O3/c1-3-5-6-7-8-9-15-26-22-13-10-12-21(17-22)25(30)23-19-27(18-20(23)4-2)16-11-14-24(28)29/h10,12-13,17-19,26H,3-9,11,14-16H2,1-2H3,(H,28,29) |
| InChIKey | VFKZODMNWGNKSS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|