C25H35ClN2O3 — CID 139750183
ethyl 4-[3-[3-(5-chloropentylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate (PubChem CID 139750183) has the molecular formula C25H35ClN2O3 and a molecular weight of 447.02 g/mol. Its IUPAC name is ethyl 4-[3-[3-(5-chloropentylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[3-(5-chloropentylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 139750183 |
| Molecular Formula | C25H35ClN2O3 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | ethyl 4-[3-[3-(5-chloropentylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(C(=O)c2cccc(NCCCCCCl)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C25H35ClN2O3/c1-4-31-24(29)12-9-15-28-17-22(19(2)3)23(18-28)25(30)20-10-8-11-21(16-20)27-14-7-5-6-13-26/h8,10-11,16-19,27H,4-7,9,12-15H2,1-3H3 |
| InChIKey | DTLKIHQRHILSQB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|