C33H51N2NaO3 — CID 139750322
sodium 4-[3-[3-(pentadecan-8-ylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate (PubChem CID 139750322) has the molecular formula C33H51N2NaO3 and a molecular weight of 546.77 g/mol. Its IUPAC name is sodium 4-[3-[3-(pentadecan-8-ylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate.
| Compound Name | sodium 4-[3-[3-(pentadecan-8-ylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 139750322 |
| Molecular Formula | C33H51N2NaO3 |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | sodium 4-[3-[3-(pentadecan-8-ylamino)benzoyl]-4-propan-2-ylpyrrol-1-yl]butanoate |
| SMILES | CCCCCCCC(CCCCCCC)Nc1cccc(C(=O)c2cn(CCCC(=O)[O-])cc2C(C)C)c1.[Na+] |
| InChI | InChI=1S/C33H52N2O3.Na/c1-5-7-9-11-13-18-28(19-14-12-10-8-6-2)34-29-20-15-17-27(23-29)33(38)31-25-35(22-16-21-32(36)37)24-30(31)26(3)4;/h15,17,20,23-26,28,34H,5-14,16,18-19,21-22H2,1-4H3,(H,36,37);/q;+1/p-1 |
| InChIKey | UALCQRWGETUIQN-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|