C18H30N2O — CID 43676007
3-(octan-2-ylamino)-N-propylbenzamide (PubChem CID 43676007) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-(octan-2-ylamino)-N-propylbenzamide.
| Compound Name | 3-(octan-2-ylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 43676007 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 3-(octan-2-ylamino)-N-propylbenzamide |
| SMILES | CCCCCCC(C)Nc1cccc(C(=O)NCCC)c1 |
| InChI | InChI=1S/C18H30N2O/c1-4-6-7-8-10-15(3)20-17-12-9-11-16(14-17)18(21)19-13-5-2/h9,11-12,14-15,20H,4-8,10,13H2,1-3H3,(H,19,21) |
| InChIKey | ZRCGILGOOSOLTB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|