C31H56N2O2 — CID 155048731
N-[2-[[(2S)-heptan-2-yl]amino]ethyl]-3-(2-hexylnonoxy)benzamide (PubChem CID 155048731) has the molecular formula C31H56N2O2 and a molecular weight of 488.80 g/mol. Its IUPAC name is N-[2-[[(2S)-heptan-2-yl]amino]ethyl]-3-(2-hexylnonoxy)benzamide.
| Compound Name | N-[2-[[(2S)-heptan-2-yl]amino]ethyl]-3-(2-hexylnonoxy)benzamide |
|---|---|
| PubChem CID | 155048731 |
| Molecular Formula | C31H56N2O2 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.43 |
| IUPAC Name | N-[2-[[(2S)-heptan-2-yl]amino]ethyl]-3-(2-hexylnonoxy)benzamide |
| SMILES | CCCCCCCC(CCCCCC)COc1cccc(C(=O)NCCN[C@@H](C)CCCCC)c1 |
| InChI | InChI=1S/C31H56N2O2/c1-5-8-11-13-16-20-28(19-15-12-9-6-2)26-35-30-22-17-21-29(25-30)31(34)33-24-23-32-27(4)18-14-10-7-3/h17,21-22,25,27-28,32H,5-16,18-20,23-24,26H2,1-4H3,(H,33,34)/t27-,28?/m0/s1 |
| InChIKey | CRLGABYAEUJTDU-MBMZGMDYSA-N |
| XLogP | 8.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|