C24H42N2O5 — CID 170145792
N-[2-[2-[2-[3-(butan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-3-(2-methylpropoxy)benzamide (PubChem CID 170145792) has the molecular formula C24H42N2O5 and a molecular weight of 438.61 g/mol. Its IUPAC name is N-[2-[2-[2-[3-(butan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-3-(2-methylpropoxy)benzamide.
| Compound Name | N-[2-[2-[2-[3-(butan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 170145792 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | N-[2-[2-[2-[3-(butan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-3-(2-methylpropoxy)benzamide |
| SMILES | CCC(C)NCCCOCCOCCOCCNC(=O)c1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C24H42N2O5/c1-5-21(4)25-10-7-12-28-14-16-30-17-15-29-13-11-26-24(27)22-8-6-9-23(18-22)31-19-20(2)3/h6,8-9,18,20-21,25H,5,7,10-17,19H2,1-4H3,(H,26,27) |
| InChIKey | ICVZWNPZGZBSTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|