C32H60N2O7S2 — CID 166552125
3-[2-(tert-butyldisulfanyl)-2-[2-(2-methylpropoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide;ethane (PubChem CID 166552125) has the molecular formula C32H60N2O7S2 and a molecular weight of 648.97 g/mol. Its IUPAC name is 3-[2-(tert-butyldisulfanyl)-2-[2-(2-methylpropoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide;ethane.
| Compound Name | 3-[2-(tert-butyldisulfanyl)-2-[2-(2-methylpropoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide;ethane |
|---|---|
| PubChem CID | 166552125 |
| Molecular Formula | C32H60N2O7S2 |
| Molecular Weight | 648.97 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | 3-[2-(tert-butyldisulfanyl)-2-[2-(2-methylpropoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide;ethane |
| SMILES | CC.CNCCCOCCOCCOCCNC(=O)c1cccc(OCC(C)(OCCOCC(C)C)SSC(C)(C)C)c1 |
| InChI | InChI=1S/C30H54N2O7S2.C2H6/c1-25(2)23-37-20-21-39-30(6,41-40-29(3,4)5)24-38-27-11-8-10-26(22-27)28(33)32-13-15-35-17-19-36-18-16-34-14-9-12-31-7;1-2/h8,10-11,22,25,31H,9,12-21,23-24H2,1-7H3,(H,32,33);1-2H3 |
| InChIKey | OOXZXBLCTSSIFY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.97 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|