C24H37N3O5S2 — CID 170111225
3-[2-(tert-butyldisulfanyl)-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide (PubChem CID 170111225) has the molecular formula C24H37N3O5S2 and a molecular weight of 511.71 g/mol. Its IUPAC name is 3-[2-(tert-butyldisulfanyl)-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-[2-(tert-butyldisulfanyl)-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 170111225 |
| Molecular Formula | C24H37N3O5S2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 3-[2-(tert-butyldisulfanyl)-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CC#CCNC(=O)COCCOC(COc1cccc(C(=O)NCCNC)c1)SSC(C)(C)C |
| InChI | InChI=1S/C24H37N3O5S2/c1-6-7-11-26-21(28)17-30-14-15-31-22(33-34-24(2,3)4)18-32-20-10-8-9-19(16-20)23(29)27-13-12-25-5/h8-10,16,22,25H,11-15,17-18H2,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | QWBAIWDOQCDNCF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|