C17H28N4O5 — CID 167024259
N-(2-aminoethyl)-3-[2-amino-2-[2-[2-(ethylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide (PubChem CID 167024259) has the molecular formula C17H28N4O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[2-amino-2-[2-[2-(ethylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide.
| Compound Name | N-(2-aminoethyl)-3-[2-amino-2-[2-[2-(ethylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 167024259 |
| Molecular Formula | C17H28N4O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-(2-aminoethyl)-3-[2-amino-2-[2-[2-(ethylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide |
| SMILES | CCNC(=O)COCCOC(N)COc1cccc(C(=O)NCCN)c1 |
| InChI | InChI=1S/C17H28N4O5/c1-2-20-16(22)12-24-8-9-25-15(19)11-26-14-5-3-4-13(10-14)17(23)21-7-6-18/h3-5,10,15H,2,6-9,11-12,18-19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | VRYMIQSPEUKDOD-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|