C16H26N2O4 — CID 177339167
1-[2-[1-amino-2-[3-(3-aminopropyl)phenoxy]ethoxy]ethoxy]propan-2-one (PubChem CID 177339167) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-[2-[1-amino-2-[3-(3-aminopropyl)phenoxy]ethoxy]ethoxy]propan-2-one.
| Compound Name | 1-[2-[1-amino-2-[3-(3-aminopropyl)phenoxy]ethoxy]ethoxy]propan-2-one |
|---|---|
| PubChem CID | 177339167 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-[2-[1-amino-2-[3-(3-aminopropyl)phenoxy]ethoxy]ethoxy]propan-2-one |
| SMILES | CC(=O)COCCOC(N)COc1cccc(CCCN)c1 |
| InChI | InChI=1S/C16H26N2O4/c1-13(19)11-20-8-9-21-16(18)12-22-15-6-2-4-14(10-15)5-3-7-17/h2,4,6,10,16H,3,5,7-9,11-12,17-18H2,1H3 |
| InChIKey | GNVKVXHCECZMTI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|