C15H23N3O5 — CID 146528382
3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-methylbenzamide (PubChem CID 146528382) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-methylbenzamide.
| Compound Name | 3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 146528382 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-methylbenzamide |
| SMILES | CNC(=O)COCCOC(N)COc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C15H23N3O5/c1-17-14(19)10-21-6-7-22-13(16)9-23-12-5-3-4-11(8-12)15(20)18-2/h3-5,8,13H,6-7,9-10,16H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | UCAJIRVWZDSELZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|