C26H42BN4O6 — CID 153336637
CID 153336637 (PubChem CID 153336637) has the molecular formula C26H42BN4O6 and a molecular weight of 517.46 g/mol.
| Compound Name | CID 153336637 |
|---|---|
| PubChem CID | 153336637 |
| Molecular Formula | C26H42BN4O6 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | — |
| SMILES | CC(C)[B]C#CCOCCNC(=O)COCCOC(N)COc1cccc(C(=O)NCCNC(C)C)c1 |
| InChI | InChI=1S/C26H42BN4O6/c1-20(2)27-9-6-13-34-14-12-30-25(32)19-35-15-16-36-24(28)18-37-23-8-5-7-22(17-23)26(33)31-11-10-29-21(3)4/h5,7-8,17,20-21,24,29H,10-16,18-19,28H2,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | MMUIVHIUWHFLNH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|