C20H31N5O6S — CID 166770573
1-sulfanylethyl 2-[2-[1-azido-2-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]ethoxy]ethoxy]acetate (PubChem CID 166770573) has the molecular formula C20H31N5O6S and a molecular weight of 469.56 g/mol. Its IUPAC name is 1-sulfanylethyl 2-[2-[1-azido-2-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]ethoxy]ethoxy]acetate.
| Compound Name | 1-sulfanylethyl 2-[2-[1-azido-2-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 166770573 |
| Molecular Formula | C20H31N5O6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 1-sulfanylethyl 2-[2-[1-azido-2-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)NCCNC(=O)c1cccc(OCC(N=[N+]=[N-])OCCOCC(=O)OC(C)S)c1 |
| InChI | InChI=1S/C20H31N5O6S/c1-14(2)22-7-8-23-20(27)16-5-4-6-17(11-16)30-12-18(24-25-21)29-10-9-28-13-19(26)31-15(3)32/h4-6,11,14-15,18,22,32H,7-10,12-13H2,1-3H3,(H,23,27) |
| InChIKey | YZFKHJBYKXQYNO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|