C23H38N6O5 — CID 164792384
3-[2-azido-2-[2-[2-(tert-butylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(tert-butylamino)ethyl]benzamide (PubChem CID 164792384) has the molecular formula C23H38N6O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-[2-azido-2-[2-[2-(tert-butylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(tert-butylamino)ethyl]benzamide.
| Compound Name | 3-[2-azido-2-[2-[2-(tert-butylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(tert-butylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 164792384 |
| Molecular Formula | C23H38N6O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 3-[2-azido-2-[2-[2-(tert-butylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(tert-butylamino)ethyl]benzamide |
| SMILES | CC(C)(C)NCCNC(=O)c1cccc(OCC(N=[N+]=[N-])OCCOCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C23H38N6O5/c1-22(2,3)26-11-10-25-21(31)17-8-7-9-18(14-17)34-16-20(28-29-24)33-13-12-32-15-19(30)27-23(4,5)6/h7-9,14,20,26H,10-13,15-16H2,1-6H3,(H,25,31)(H,27,30) |
| InChIKey | URWDLDADPGINNB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|