C26H40N6O6 — CID 159308381
3-[2-azido-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 159308381) has the molecular formula C26H40N6O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-[2-azido-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3-[2-azido-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 159308381 |
| Molecular Formula | C26H40N6O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 3-[2-azido-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)C#CCOCCNC(=O)COCCOC(COc1cccc(C(=O)NCCNC(C)C)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C26H40N6O6/c1-20(2)7-6-13-35-14-12-29-24(33)18-36-15-16-37-25(31-32-27)19-38-23-9-5-8-22(17-23)26(34)30-11-10-28-21(3)4/h5,8-9,17,20-21,25,28H,10-16,18-19H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | LCFFLKYDCJIGGQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|