C24H38N4O6 — CID 146260560
3-[2-amino-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide (PubChem CID 146260560) has the molecular formula C24H38N4O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-[2-amino-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-[2-amino-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 146260560 |
| Molecular Formula | C24H38N4O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 3-[2-amino-2-[2-[2-[2-(4-methylpent-2-ynoxy)ethylamino]-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cccc(OCC(N)OCCOCC(=O)NCCOCC#CC(C)C)c1 |
| InChI | InChI=1S/C24H38N4O6/c1-19(2)6-5-12-31-13-11-27-23(29)18-32-14-15-33-22(25)17-34-21-8-4-7-20(16-21)24(30)28-10-9-26-3/h4,7-8,16,19,22,26H,9-15,17-18,25H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | SSOHFKDHFAFMQR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|