C30H47N3O7 — CID 154642941
N-[2-(methylamino)ethyl]-3-[[1-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]cyclopropyl]methoxy]benzamide (PubChem CID 154642941) has the molecular formula C30H47N3O7 and a molecular weight of 561.72 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-[[1-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]cyclopropyl]methoxy]benzamide.
| Compound Name | N-[2-(methylamino)ethyl]-3-[[1-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]cyclopropyl]methoxy]benzamide |
|---|---|
| PubChem CID | 154642941 |
| Molecular Formula | C30H47N3O7 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-[[1-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]cyclopropyl]methoxy]benzamide |
| SMILES | CNCCNC(=O)c1cccc(OCC2(OCCOCCOCCCC(=O)NCCOCC#CC(C)C)CC2)c1 |
| InChI | InChI=1S/C30H47N3O7/c1-25(2)7-5-16-36-18-15-32-28(34)10-6-17-37-19-20-38-21-22-40-30(11-12-30)24-39-27-9-4-8-26(23-27)29(35)33-14-13-31-3/h4,8-9,23,25,31H,6,10-22,24H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | VIWQGYDDLWZZQA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|