C34H55N3O6S2 — CID 164933484
3-[2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(7-methyloctanoylamino)ethyl]benzamide (PubChem CID 164933484) has the molecular formula C34H55N3O6S2 and a molecular weight of 665.96 g/mol. Its IUPAC name is 3-[2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(7-methyloctanoylamino)ethyl]benzamide.
| Compound Name | 3-[2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(7-methyloctanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 164933484 |
| Molecular Formula | C34H55N3O6S2 |
| Molecular Weight | 665.96 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | 3-[2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(7-methyloctanoylamino)ethyl]benzamide |
| SMILES | CC(C)C#CCNC(=O)COCCOC(COc1cccc(C(=O)NCCNC(=O)CCCCCC(C)C)c1)SSC(C)(C)C |
| InChI | InChI=1S/C34H55N3O6S2/c1-26(2)13-9-8-10-17-30(38)36-19-20-37-33(40)28-15-11-16-29(23-28)43-25-32(44-45-34(5,6)7)42-22-21-41-24-31(39)35-18-12-14-27(3)4/h11,15-16,23,26-27,32H,8-10,13,17-22,24-25H2,1-7H3,(H,35,39)(H,36,38)(H,37,40) |
| InChIKey | OFTRIIPBYHCKBR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.96 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|