C21H36N2O4S4 — CID 170145757
3-[2-(tert-butyldisulfanyl)-2-[2-(2-sulfanylpropoxy)ethoxy]ethoxy]-N-[2-(methylsulfanylamino)ethyl]benzamide (PubChem CID 170145757) has the molecular formula C21H36N2O4S4 and a molecular weight of 508.80 g/mol. Its IUPAC name is 3-[2-(tert-butyldisulfanyl)-2-[2-(2-sulfanylpropoxy)ethoxy]ethoxy]-N-[2-(methylsulfanylamino)ethyl]benzamide.
| Compound Name | 3-[2-(tert-butyldisulfanyl)-2-[2-(2-sulfanylpropoxy)ethoxy]ethoxy]-N-[2-(methylsulfanylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 170145757 |
| Molecular Formula | C21H36N2O4S4 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 3-[2-(tert-butyldisulfanyl)-2-[2-(2-sulfanylpropoxy)ethoxy]ethoxy]-N-[2-(methylsulfanylamino)ethyl]benzamide |
| SMILES | CSNCCNC(=O)c1cccc(OCC(OCCOCC(C)S)SSC(C)(C)C)c1 |
| InChI | InChI=1S/C21H36N2O4S4/c1-16(28)14-25-11-12-26-19(30-31-21(2,3)4)15-27-18-8-6-7-17(13-18)20(24)22-9-10-23-29-5/h6-8,13,16,19,23,28H,9-12,14-15H2,1-5H3,(H,22,24) |
| InChIKey | WEKJXPRGIYJXGY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|