C26H41N3O5S2 — CID 155242850
3-[(2S)-2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide (PubChem CID 155242850) has the molecular formula C26H41N3O5S2 and a molecular weight of 539.76 g/mol. Its IUPAC name is 3-[(2S)-2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-[(2S)-2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 155242850 |
| Molecular Formula | C26H41N3O5S2 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 3-[(2S)-2-(tert-butyldisulfanyl)-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cccc(OC[C@@H](OCCOCC(=O)NCC#CC(C)C)SSC(C)(C)C)c1 |
| InChI | InChI=1S/C26H41N3O5S2/c1-20(2)9-8-12-28-23(30)18-32-15-16-33-24(35-36-26(3,4)5)19-34-22-11-7-10-21(17-22)25(31)29-14-13-27-6/h7,10-11,17,20,24,27H,12-16,18-19H2,1-6H3,(H,28,30)(H,29,31)/t24-/m0/s1 |
| InChIKey | SKTOJMYPBNASJW-DEOSSOPVSA-N |
| XLogP | 3.33 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|